C17H10Cl3F2N3O2 — CID 155708509
1-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-2-(2,6-dichloroanilino)ethanone (PubChem CID 155708509) has the molecular formula C17H10Cl3F2N3O2 and a molecular weight of 432.64 g/mol. Its IUPAC name is 1-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-2-(2,6-dichloroanilino)ethanone.
| Compound Name | 1-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-2-(2,6-dichloroanilino)ethanone |
|---|---|
| PubChem CID | 155708509 |
| Molecular Formula | C17H10Cl3F2N3O2 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 1-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-2-(2,6-dichloroanilino)ethanone |
| SMILES | O=C(CNc1c(Cl)cccc1Cl)c1ccc(-c2noc(C(F)(F)Cl)n2)cc1 |
| InChI | InChI=1S/C17H10Cl3F2N3O2/c18-11-2-1-3-12(19)14(11)23-8-13(26)9-4-6-10(7-5-9)15-24-16(27-25-15)17(20,21)22/h1-7,23H,8H2 |
| InChIKey | ODUYIVABIJHXMR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|