C11H11ClF2N3O2P — CID 162734350
N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-methylphosphoryl]methanamine (PubChem CID 162734350) has the molecular formula C11H11ClF2N3O2P and a molecular weight of 321.65 g/mol. Its IUPAC name is N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-methylphosphoryl]methanamine.
| Compound Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-methylphosphoryl]methanamine |
|---|---|
| PubChem CID | 162734350 |
| Molecular Formula | C11H11ClF2N3O2P |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-methylphosphoryl]methanamine |
| SMILES | CNP(C)(=O)c1ccc(-c2noc(C(F)(F)Cl)n2)cc1 |
| InChI | InChI=1S/C11H11ClF2N3O2P/c1-15-20(2,18)8-5-3-7(4-6-8)9-16-10(19-17-9)11(12,13)14/h3-6H,1-2H3,(H,15,18) |
| InChIKey | RXIUPLKQLVACNH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|