C21H15ClF2N4O3 — CID 155191837
3-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]anilino]-4-[(4-methylphenyl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 155191837) has the molecular formula C21H15ClF2N4O3 and a molecular weight of 444.83 g/mol. Its IUPAC name is 3-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]anilino]-4-[(4-methylphenyl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]anilino]-4-[(4-methylphenyl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155191837 |
| Molecular Formula | C21H15ClF2N4O3 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 3-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]anilino]-4-[(4-methylphenyl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | Cc1ccc(CNc2c(Nc3ccc(-c4noc(C(F)(F)Cl)n4)cc3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C21H15ClF2N4O3/c1-11-2-4-12(5-3-11)10-25-15-16(18(30)17(15)29)26-14-8-6-13(7-9-14)19-27-20(31-28-19)21(22,23)24/h2-9,25-26H,10H2,1H3 |
| InChIKey | ZSUMSDIMGMVFNB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|