C15H11ClF2N4O3 — CID 155192123
3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione (PubChem CID 155192123) has the molecular formula C15H11ClF2N4O3 and a molecular weight of 368.73 g/mol. Its IUPAC name is 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155192123 |
| Molecular Formula | C15H11ClF2N4O3 |
| Molecular Weight | 368.73 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]-4-(methylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CNc1c(NCc2ccc(-c3noc(C(F)(F)Cl)n3)cc2)c(=O)c1=O |
| InChI | InChI=1S/C15H11ClF2N4O3/c1-19-9-10(12(24)11(9)23)20-6-7-2-4-8(5-3-7)13-21-14(25-22-13)15(16,17)18/h2-5,19-20H,6H2,1H3 |
| InChIKey | CDULPBAHVRWXNP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.73 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|