C17H13ClF4N3O2P — CID 162734183
N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylphosphoryl]-3,4-difluoroaniline (PubChem CID 162734183) has the molecular formula C17H13ClF4N3O2P and a molecular weight of 433.73 g/mol. Its IUPAC name is N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylphosphoryl]-3,4-difluoroaniline.
| Compound Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylphosphoryl]-3,4-difluoroaniline |
|---|---|
| PubChem CID | 162734183 |
| Molecular Formula | C17H13ClF4N3O2P |
| Molecular Weight | 433.73 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylphosphoryl]-3,4-difluoroaniline |
| SMILES | CP(=O)(Cc1ccc(-c2noc(C(F)(F)Cl)n2)cc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H13ClF4N3O2P/c1-28(26,25-12-6-7-13(19)14(20)8-12)9-10-2-4-11(5-3-10)15-23-16(27-24-15)17(18,21)22/h2-8H,9H2,1H3,(H,25,26) |
| InChIKey | TXSSYCDRASGIFW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|