C19H18ClF3N3O3P — CID 162734194
N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methyl-ethoxyphosphoryl]-1-phenylmethanamine (PubChem CID 162734194) has the molecular formula C19H18ClF3N3O3P and a molecular weight of 459.79 g/mol. Its IUPAC name is N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methyl-ethoxyphosphoryl]-1-phenylmethanamine.
| Compound Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methyl-ethoxyphosphoryl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 162734194 |
| Molecular Formula | C19H18ClF3N3O3P |
| Molecular Weight | 459.79 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methyl-ethoxyphosphoryl]-1-phenylmethanamine |
| SMILES | CCOP(=O)(Cc1ccc(-c2noc(C(F)(F)Cl)n2)cc1F)NCc1ccccc1 |
| InChI | InChI=1S/C19H18ClF3N3O3P/c1-2-28-30(27,24-11-13-6-4-3-5-7-13)12-15-9-8-14(10-16(15)21)17-25-18(29-26-17)19(20,22)23/h3-10H,2,11-12H2,1H3,(H,24,27) |
| InChIKey | PHOLFKLXJTXHLG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.79 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|