C18H14ClF5N3O3P — CID 162734424
N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methyl-ethoxyphosphoryl]-3,4-difluoroaniline (PubChem CID 162734424) has the molecular formula C18H14ClF5N3O3P and a molecular weight of 481.75 g/mol. Its IUPAC name is N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methyl-ethoxyphosphoryl]-3,4-difluoroaniline.
| Compound Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methyl-ethoxyphosphoryl]-3,4-difluoroaniline |
|---|---|
| PubChem CID | 162734424 |
| Molecular Formula | C18H14ClF5N3O3P |
| Molecular Weight | 481.75 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methyl-ethoxyphosphoryl]-3,4-difluoroaniline |
| SMILES | CCOP(=O)(Cc1ccc(-c2noc(C(F)(F)Cl)n2)cc1F)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H14ClF5N3O3P/c1-2-29-31(28,27-12-5-6-13(20)15(22)8-12)9-11-4-3-10(7-14(11)21)16-25-17(30-26-16)18(19,23)24/h3-8H,2,9H2,1H3,(H,27,28) |
| InChIKey | GEZFHDUHZIXOHH-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|