C18H17ClF2N3O2P — CID 162734404
N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylphosphoryl]-3-methylaniline (PubChem CID 162734404) has the molecular formula C18H17ClF2N3O2P and a molecular weight of 411.78 g/mol. Its IUPAC name is N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylphosphoryl]-3-methylaniline.
| Compound Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylphosphoryl]-3-methylaniline |
|---|---|
| PubChem CID | 162734404 |
| Molecular Formula | C18H17ClF2N3O2P |
| Molecular Weight | 411.78 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | N-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylphosphoryl]-3-methylaniline |
| SMILES | Cc1cccc(NP(C)(=O)Cc2ccc(-c3noc(C(F)(F)Cl)n3)cc2)c1 |
| InChI | InChI=1S/C18H17ClF2N3O2P/c1-12-4-3-5-15(10-12)24-27(2,25)11-13-6-8-14(9-7-13)16-22-17(26-23-16)18(19,20)21/h3-10H,11H2,1-2H3,(H,24,25) |
| InChIKey | UTPCMFUSQSOGAB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.78 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|