C12H14ClF2N4O2P — CID 162734277
N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-methylphosphoryl]ethanamine (PubChem CID 162734277) has the molecular formula C12H14ClF2N4O2P and a molecular weight of 350.69 g/mol. Its IUPAC name is N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-methylphosphoryl]ethanamine.
| Compound Name | N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-methylphosphoryl]ethanamine |
|---|---|
| PubChem CID | 162734277 |
| Molecular Formula | C12H14ClF2N4O2P |
| Molecular Weight | 350.69 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-[[5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl-methylphosphoryl]ethanamine |
| SMILES | CCNP(C)(=O)Cc1ccc(-c2noc(C(F)(F)Cl)n2)cn1 |
| InChI | InChI=1S/C12H14ClF2N4O2P/c1-3-17-22(2,20)7-9-5-4-8(6-16-9)10-18-11(21-19-10)12(13,14)15/h4-6H,3,7H2,1-2H3,(H,17,20) |
| InChIKey | FOARPGWKDXAWGU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|