C14H15ClF2N3O3P — CID 162734476
4-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-methylphosphoryl]morpholine (PubChem CID 162734476) has the molecular formula C14H15ClF2N3O3P and a molecular weight of 377.72 g/mol. Its IUPAC name is 4-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-methylphosphoryl]morpholine.
| Compound Name | 4-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-methylphosphoryl]morpholine |
|---|---|
| PubChem CID | 162734476 |
| Molecular Formula | C14H15ClF2N3O3P |
| Molecular Weight | 377.72 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 4-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-methylphosphoryl]morpholine |
| SMILES | CP(=O)(c1ccc(-c2noc(C(F)(F)Cl)n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C14H15ClF2N3O3P/c1-24(21,20-6-8-22-9-7-20)11-4-2-10(3-5-11)12-18-13(23-19-12)14(15,16)17/h2-5H,6-9H2,1H3 |
| InChIKey | JAQQGZPVGBXRAO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|