C17H12ClF3N4O3 — CID 155191953
3-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]anilino]-4-(3-fluoropyrrolidin-1-yl)cyclobut-3-ene-1,2-dione (PubChem CID 155191953) has the molecular formula C17H12ClF3N4O3 and a molecular weight of 412.76 g/mol. Its IUPAC name is 3-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]anilino]-4-(3-fluoropyrrolidin-1-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]anilino]-4-(3-fluoropyrrolidin-1-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155191953 |
| Molecular Formula | C17H12ClF3N4O3 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]anilino]-4-(3-fluoropyrrolidin-1-yl)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2ccc(-c3noc(C(F)(F)Cl)n3)cc2)c(N2CCC(F)C2)c1=O |
| InChI | InChI=1S/C17H12ClF3N4O3/c18-17(20,21)16-23-15(24-28-16)8-1-3-10(4-2-8)22-11-12(14(27)13(11)26)25-6-5-9(19)7-25/h1-4,9,22H,5-7H2 |
| InChIKey | AUZFNLZMJVJSHA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|