C18H17ClF2N4O4 — CID 155191964
3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylamino]-4-(2-methoxyethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 155191964) has the molecular formula C18H17ClF2N4O4 and a molecular weight of 426.81 g/mol. Its IUPAC name is 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylamino]-4-(2-methoxyethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylamino]-4-(2-methoxyethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155191964 |
| Molecular Formula | C18H17ClF2N4O4 |
| Molecular Weight | 426.81 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl-methylamino]-4-(2-methoxyethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | COCCNc1c(N(C)Cc2ccc(-c3noc(C(F)(F)Cl)n3)cc2)c(=O)c1=O |
| InChI | InChI=1S/C18H17ClF2N4O4/c1-25(13-12(14(26)15(13)27)22-7-8-28-2)9-10-3-5-11(6-4-10)16-23-17(29-24-16)18(19,20)21/h3-6,22H,7-9H2,1-2H3 |
| InChIKey | YZCPUQWYXIKEEV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.81 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|