C15H16F3N3O4 — CID 155768779
N,3-dimethoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide (PubChem CID 155768779) has the molecular formula C15H16F3N3O4 and a molecular weight of 359.30 g/mol. Its IUPAC name is N,3-dimethoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide.
| Compound Name | N,3-dimethoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 155768779 |
| Molecular Formula | C15H16F3N3O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N,3-dimethoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide |
| SMILES | COCCC(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)OC |
| InChI | InChI=1S/C15H16F3N3O4/c1-23-8-7-12(22)21(24-2)9-10-3-5-11(6-4-10)13-19-14(25-20-13)15(16,17)18/h3-6H,7-9H2,1-2H3 |
| InChIKey | JFCPPYWDCBNHCP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|