C17H20F3N3O4 — CID 155768248
3-methoxy-N-propoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide (PubChem CID 155768248) has the molecular formula C17H20F3N3O4 and a molecular weight of 387.36 g/mol. Its IUPAC name is 3-methoxy-N-propoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide.
| Compound Name | 3-methoxy-N-propoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 155768248 |
| Molecular Formula | C17H20F3N3O4 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 3-methoxy-N-propoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide |
| SMILES | CCCON(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C(=O)CCOC |
| InChI | InChI=1S/C17H20F3N3O4/c1-3-9-26-23(14(24)8-10-25-2)11-12-4-6-13(7-5-12)15-21-16(27-22-15)17(18,19)20/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | JIVLJVVGJSQORU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|