C18H23F3N4O5 — CID 146521234
1-methoxy-3,3-bis(2-methoxyethyl)-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea (PubChem CID 146521234) has the molecular formula C18H23F3N4O5 and a molecular weight of 432.40 g/mol. Its IUPAC name is 1-methoxy-3,3-bis(2-methoxyethyl)-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea.
| Compound Name | 1-methoxy-3,3-bis(2-methoxyethyl)-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 146521234 |
| Molecular Formula | C18H23F3N4O5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-methoxy-3,3-bis(2-methoxyethyl)-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
| SMILES | COCCN(CCOC)C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)OC |
| InChI | InChI=1S/C18H23F3N4O5/c1-27-10-8-24(9-11-28-2)17(26)25(29-3)12-13-4-6-14(7-5-13)15-22-16(30-23-15)18(19,20)21/h4-7H,8-12H2,1-3H3 |
| InChIKey | YYRLZMXLPXQTGX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|