C15H15F3N4O4 — CID 137366634
(2E)-N-methoxy-2-methoxyimino-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide (PubChem CID 137366634) has the molecular formula C15H15F3N4O4 and a molecular weight of 372.30 g/mol. Its IUPAC name is (2E)-N-methoxy-2-methoxyimino-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide.
| Compound Name | (2E)-N-methoxy-2-methoxyimino-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 137366634 |
| Molecular Formula | C15H15F3N4O4 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | (2E)-N-methoxy-2-methoxyimino-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]propanamide |
| SMILES | CO/N=C(\C)C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)OC |
| InChI | InChI=1S/C15H15F3N4O4/c1-9(20-24-2)13(23)22(25-3)8-10-4-6-11(7-5-10)12-19-14(26-21-12)15(16,17)18/h4-7H,8H2,1-3H3/b20-9+ |
| InChIKey | PGILVLSPALSOGR-AWQFTUOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|