C16H14F3N3O6 — CID 137366768
oxetan-3-yl 2-[methoxy-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-2-oxoacetate (PubChem CID 137366768) has the molecular formula C16H14F3N3O6 and a molecular weight of 401.30 g/mol. Its IUPAC name is oxetan-3-yl 2-[methoxy-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-2-oxoacetate.
| Compound Name | oxetan-3-yl 2-[methoxy-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 137366768 |
| Molecular Formula | C16H14F3N3O6 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | oxetan-3-yl 2-[methoxy-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-2-oxoacetate |
| SMILES | CON(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C(=O)C(=O)OC1COC1 |
| InChI | InChI=1S/C16H14F3N3O6/c1-25-22(13(23)14(24)27-11-7-26-8-11)6-9-2-4-10(5-3-9)12-20-15(28-21-12)16(17,18)19/h2-5,11H,6-8H2,1H3 |
| InChIKey | DSINMFYFTSVJID-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 103.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|