C17H12F3N3O4S — CID 137366637
N-methoxy-2-oxo-2-thiophen-2-yl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide (PubChem CID 137366637) has the molecular formula C17H12F3N3O4S and a molecular weight of 411.36 g/mol. Its IUPAC name is N-methoxy-2-oxo-2-thiophen-2-yl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide.
| Compound Name | N-methoxy-2-oxo-2-thiophen-2-yl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 137366637 |
| Molecular Formula | C17H12F3N3O4S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | N-methoxy-2-oxo-2-thiophen-2-yl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide |
| SMILES | CON(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C(=O)C(=O)c1cccs1 |
| InChI | InChI=1S/C17H12F3N3O4S/c1-26-23(15(25)13(24)12-3-2-8-28-12)9-10-4-6-11(7-5-10)14-21-16(27-22-14)17(18,19)20/h2-8H,9H2,1H3 |
| InChIKey | PTJUWTAGHUOFCZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|