C16H14F3N3O4 — CID 146521126
but-2-ynyl N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]carbamate (PubChem CID 146521126) has the molecular formula C16H14F3N3O4 and a molecular weight of 369.30 g/mol. Its IUPAC name is but-2-ynyl N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]carbamate.
| Compound Name | but-2-ynyl N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 146521126 |
| Molecular Formula | C16H14F3N3O4 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | but-2-ynyl N-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]carbamate |
| SMILES | CC#CCOC(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)OC |
| InChI | InChI=1S/C16H14F3N3O4/c1-3-4-9-25-15(23)22(24-2)10-11-5-7-12(8-6-11)13-20-14(26-21-13)16(17,18)19/h5-8H,9-10H2,1-2H3 |
| InChIKey | ZWJKWJGJIPJQAV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|