C16H19F3N4O3 — CID 146521098
1-methoxy-3-methyl-3-propan-2-yl-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea (PubChem CID 146521098) has the molecular formula C16H19F3N4O3 and a molecular weight of 372.35 g/mol. Its IUPAC name is 1-methoxy-3-methyl-3-propan-2-yl-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea.
| Compound Name | 1-methoxy-3-methyl-3-propan-2-yl-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 146521098 |
| Molecular Formula | C16H19F3N4O3 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-methoxy-3-methyl-3-propan-2-yl-1-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
| SMILES | CON(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C(=O)N(C)C(C)C |
| InChI | InChI=1S/C16H19F3N4O3/c1-10(2)22(3)15(24)23(25-4)9-11-5-7-12(8-6-11)13-20-14(26-21-13)16(17,18)19/h5-8,10H,9H2,1-4H3 |
| InChIKey | LSYPHWHRYPINIV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|