C19H16F3N3O4 — CID 155768785
N,2-dimethoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]benzamide (PubChem CID 155768785) has the molecular formula C19H16F3N3O4 and a molecular weight of 407.35 g/mol. Its IUPAC name is N,2-dimethoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]benzamide.
| Compound Name | N,2-dimethoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 155768785 |
| Molecular Formula | C19H16F3N3O4 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N,2-dimethoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]benzamide |
| SMILES | COc1ccccc1C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)OC |
| InChI | InChI=1S/C19H16F3N3O4/c1-27-15-6-4-3-5-14(15)17(26)25(28-2)11-12-7-9-13(10-8-12)16-23-18(29-24-16)19(20,21)22/h3-10H,11H2,1-2H3 |
| InChIKey | WMIYQIQAAYGXIH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|