C17H12ClF3N4O3 — CID 155768845
2-chloro-N-methoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl]benzamide (PubChem CID 155768845) has the molecular formula C17H12ClF3N4O3 and a molecular weight of 412.76 g/mol. Its IUPAC name is 2-chloro-N-methoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl]benzamide.
| Compound Name | 2-chloro-N-methoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 155768845 |
| Molecular Formula | C17H12ClF3N4O3 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-chloro-N-methoxy-N-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methyl]benzamide |
| SMILES | CON(Cc1ccc(-c2noc(C(F)(F)F)n2)cn1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H12ClF3N4O3/c1-27-25(15(26)12-4-2-3-5-13(12)18)9-11-7-6-10(8-22-11)14-23-16(28-24-14)17(19,20)21/h2-8H,9H2,1H3 |
| InChIKey | XGAAZCNQHFUYLL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|