C18H18F3N5O3 — CID 146521186
1-(1-cyanoethyl)-1-cyclopropyl-3-methoxy-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea (PubChem CID 146521186) has the molecular formula C18H18F3N5O3 and a molecular weight of 409.37 g/mol. Its IUPAC name is 1-(1-cyanoethyl)-1-cyclopropyl-3-methoxy-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea.
| Compound Name | 1-(1-cyanoethyl)-1-cyclopropyl-3-methoxy-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 146521186 |
| Molecular Formula | C18H18F3N5O3 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-(1-cyanoethyl)-1-cyclopropyl-3-methoxy-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
| SMILES | CON(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C(=O)N(C(C)C#N)C1CC1 |
| InChI | InChI=1S/C18H18F3N5O3/c1-11(9-22)26(14-7-8-14)17(27)25(28-2)10-12-3-5-13(6-4-12)15-23-16(29-24-15)18(19,20)21/h3-6,11,14H,7-8,10H2,1-2H3 |
| InChIKey | JBLPIJFCAVLPON-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|