C17H14F3N5O3 — CID 137366700
(1E)-2-[cyclopropyl-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-N-methoxy-2-oxoethanimidoyl cyanide (PubChem CID 137366700) has the molecular formula C17H14F3N5O3 and a molecular weight of 393.33 g/mol. Its IUPAC name is (1E)-2-[cyclopropyl-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-N-methoxy-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-2-[cyclopropyl-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-N-methoxy-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 137366700 |
| Molecular Formula | C17H14F3N5O3 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (1E)-2-[cyclopropyl-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-N-methoxy-2-oxoethanimidoyl cyanide |
| SMILES | CO/N=C(\C#N)C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C1CC1 |
| InChI | InChI=1S/C17H14F3N5O3/c1-27-23-13(8-21)15(26)25(12-6-7-12)9-10-2-4-11(5-3-10)14-22-16(28-24-14)17(18,19)20/h2-5,12H,6-7,9H2,1H3/b23-13+ |
| InChIKey | WPEIOSNJOOWLQK-YDZHTSKRSA-N |
| XLogP | 2.77 |
| TPSA | 104.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|