C22H19F3N4O3 — CID 137366718
(2Z)-N-cyclopropyl-2-methoxyimino-2-phenyl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide (PubChem CID 137366718) has the molecular formula C22H19F3N4O3 and a molecular weight of 444.41 g/mol. Its IUPAC name is (2Z)-N-cyclopropyl-2-methoxyimino-2-phenyl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide.
| Compound Name | (2Z)-N-cyclopropyl-2-methoxyimino-2-phenyl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 137366718 |
| Molecular Formula | C22H19F3N4O3 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | (2Z)-N-cyclopropyl-2-methoxyimino-2-phenyl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide |
| SMILES | CO/N=C(\C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C22H19F3N4O3/c1-31-27-18(15-5-3-2-4-6-15)20(30)29(17-11-12-17)13-14-7-9-16(10-8-14)19-26-21(32-28-19)22(23,24)25/h2-10,17H,11-13H2,1H3/b27-18- |
| InChIKey | FMQNFUJZYVHYEW-IMRQLAEWSA-N |
| XLogP | 4.30 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|