C15H12F3N5O4 — CID 137366736
(1E)-N-methoxy-2-[methoxy-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-2-oxoethanimidoyl cyanide (PubChem CID 137366736) has the molecular formula C15H12F3N5O4 and a molecular weight of 383.29 g/mol. Its IUPAC name is (1E)-N-methoxy-2-[methoxy-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-N-methoxy-2-[methoxy-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 137366736 |
| Molecular Formula | C15H12F3N5O4 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | (1E)-N-methoxy-2-[methoxy-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino]-2-oxoethanimidoyl cyanide |
| SMILES | CO/N=C(\C#N)C(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)OC |
| InChI | InChI=1S/C15H12F3N5O4/c1-25-21-11(7-19)13(24)23(26-2)8-9-3-5-10(6-4-9)12-20-14(27-22-12)15(16,17)18/h3-6H,8H2,1-2H3/b21-11+ |
| InChIKey | KNLTYWYDFPTSMS-SRZZPIQSSA-N |
| XLogP | 2.17 |
| TPSA | 113.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|