C22H21ClF3N3O4 — CID 155768631
N-[(4-chlorophenyl)methoxy]-4-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]butanamide (PubChem CID 155768631) has the molecular formula C22H21ClF3N3O4 and a molecular weight of 483.87 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methoxy]-4-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]butanamide.
| Compound Name | N-[(4-chlorophenyl)methoxy]-4-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 155768631 |
| Molecular Formula | C22H21ClF3N3O4 |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[(4-chlorophenyl)methoxy]-4-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]butanamide |
| SMILES | COCCCC(=O)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClF3N3O4/c1-31-12-2-3-19(30)29(32-14-16-6-10-18(23)11-7-16)13-15-4-8-17(9-5-15)20-27-21(33-28-20)22(24,25)26/h4-11H,2-3,12-14H2,1H3 |
| InChIKey | WFOCAICMATWDQE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|