C19H24F3N3O3 — CID 155768851
N-butan-2-yl-4-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]butanamide (PubChem CID 155768851) has the molecular formula C19H24F3N3O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is N-butan-2-yl-4-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]butanamide.
| Compound Name | N-butan-2-yl-4-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 155768851 |
| Molecular Formula | C19H24F3N3O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-butan-2-yl-4-methoxy-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]butanamide |
| SMILES | CCC(C)N(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C(=O)CCCOC |
| InChI | InChI=1S/C19H24F3N3O3/c1-4-13(2)25(16(26)6-5-11-27-3)12-14-7-9-15(10-8-14)17-23-18(28-24-17)19(20,21)22/h7-10,13H,4-6,11-12H2,1-3H3 |
| InChIKey | VNXQIZMIXGFGKY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|