C16H14F3N5O4 — CID 155708332
3-(2-methoxyethylamino)-4-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 155708332) has the molecular formula C16H14F3N5O4 and a molecular weight of 397.31 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-4-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2-methoxyethylamino)-4-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155708332 |
| Molecular Formula | C16H14F3N5O4 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 3-(2-methoxyethylamino)-4-[[5-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-2-pyridinyl]methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | COCCNc1c(NCc2ccc(-c3noc(C(F)(F)F)n3)cn2)c(=O)c1=O |
| InChI | InChI=1S/C16H14F3N5O4/c1-27-5-4-20-10-11(13(26)12(10)25)22-7-9-3-2-8(6-21-9)14-23-15(28-24-14)16(17,18)19/h2-3,6,20,22H,4-5,7H2,1H3 |
| InChIKey | VUXGOHDOIONZDA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|