C13H12F3N3O4 — CID 145340160
[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl] N-(2-methoxyethyl)carbamate (PubChem CID 145340160) has the molecular formula C13H12F3N3O4 and a molecular weight of 331.25 g/mol. Its IUPAC name is [4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl] N-(2-methoxyethyl)carbamate.
| Compound Name | [4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 145340160 |
| Molecular Formula | C13H12F3N3O4 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)Oc1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C13H12F3N3O4/c1-21-7-6-17-12(20)22-9-4-2-8(3-5-9)10-18-11(23-19-10)13(14,15)16/h2-5H,6-7H2,1H3,(H,17,20) |
| InChIKey | JUSQYXALXLSRFJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|