C14H12F3N5O3 — CID 162532709
N-(2-methoxyethyl)-7-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 162532709) has the molecular formula C14H12F3N5O3 and a molecular weight of 355.28 g/mol. Its IUPAC name is N-(2-methoxyethyl)-7-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-7-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162532709 |
| Molecular Formula | C14H12F3N5O3 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-(2-methoxyethyl)-7-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1cn2ccc(-c3noc(C(F)(F)F)n3)cc2n1 |
| InChI | InChI=1S/C14H12F3N5O3/c1-24-5-3-18-12(23)9-7-22-4-2-8(6-10(22)19-9)11-20-13(25-21-11)14(15,16)17/h2,4,6-7H,3,5H2,1H3,(H,18,23) |
| InChIKey | CLKCLLHKYDZGDR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|