C20H18F3N3O5 — CID 71557142
3,5-dimethoxy-N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]benzamide (PubChem CID 71557142) has the molecular formula C20H18F3N3O5 and a molecular weight of 437.37 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 71557142 |
| Molecular Formula | C20H18F3N3O5 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 3,5-dimethoxy-N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCOc2ccc(-c3noc(C(F)(F)F)n3)cc2)c1 |
| InChI | InChI=1S/C20H18F3N3O5/c1-28-15-9-13(10-16(11-15)29-2)18(27)24-7-8-30-14-5-3-12(4-6-14)17-25-19(31-26-17)20(21,22)23/h3-6,9-11H,7-8H2,1-2H3,(H,24,27) |
| InChIKey | MXDXEGDQUNELNU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|