C17H13F3N4O3 — CID 71558280
N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]pyridine-2-carboxamide (PubChem CID 71558280) has the molecular formula C17H13F3N4O3 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71558280 |
| Molecular Formula | C17H13F3N4O3 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(-c2noc(C(F)(F)F)n2)cc1)c1ccccn1 |
| InChI | InChI=1S/C17H13F3N4O3/c18-17(19,20)16-23-14(24-27-16)11-4-6-12(7-5-11)26-10-9-22-15(25)13-3-1-2-8-21-13/h1-8H,9-10H2,(H,22,25) |
| InChIKey | OPKDHSHXIWHAHV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|