C18H14F3N3O2S — CID 86777421
N-(2-phenylsulfanylethyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 86777421) has the molecular formula C18H14F3N3O2S and a molecular weight of 393.39 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-(2-phenylsulfanylethyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 86777421 |
| Molecular Formula | C18H14F3N3O2S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(2-phenylsulfanylethyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | O=C(NCCSc1ccccc1)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C18H14F3N3O2S/c19-18(20,21)17-23-15(24-26-17)12-6-8-13(9-7-12)16(25)22-10-11-27-14-4-2-1-3-5-14/h1-9H,10-11H2,(H,22,25) |
| InChIKey | USSWHFHJZIVJPC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|