C10H6ClF3N4O2 — CID 130442122
N'-chloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzohydrazide (PubChem CID 130442122) has the molecular formula C10H6ClF3N4O2 and a molecular weight of 306.63 g/mol. Its IUPAC name is N'-chloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzohydrazide.
| Compound Name | N'-chloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 130442122 |
| Molecular Formula | C10H6ClF3N4O2 |
| Molecular Weight | 306.63 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | N'-chloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzohydrazide |
| SMILES | O=C(NNCl)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C10H6ClF3N4O2/c11-18-16-8(19)6-3-1-5(2-4-6)7-15-9(20-17-7)10(12,13)14/h1-4,18H,(H,16,19) |
| InChIKey | BOJSBKUDOPPJGD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|