C14H14F3N3O6 — CID 90149752
N-(1,1,3,4-tetrahydroxybutan-2-yl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 90149752) has the molecular formula C14H14F3N3O6 and a molecular weight of 377.28 g/mol. Its IUPAC name is N-(1,1,3,4-tetrahydroxybutan-2-yl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-(1,1,3,4-tetrahydroxybutan-2-yl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 90149752 |
| Molecular Formula | C14H14F3N3O6 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-(1,1,3,4-tetrahydroxybutan-2-yl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | O=C(NC(C(O)O)C(O)CO)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H14F3N3O6/c15-14(16,17)13-19-10(20-26-13)6-1-3-7(4-2-6)11(23)18-9(12(24)25)8(22)5-21/h1-4,8-9,12,21-22,24-25H,5H2,(H,18,23) |
| InChIKey | PCQLHPIYOAIDMU-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|