C15H13F3N2O3 — CID 137412256
3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pentane-2,4-dione (PubChem CID 137412256) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is 3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pentane-2,4-dione.
| Compound Name | 3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 137412256 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]pentane-2,4-dione |
| SMILES | CC(=O)C(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C(C)=O |
| InChI | InChI=1S/C15H13F3N2O3/c1-8(21)12(9(2)22)7-10-3-5-11(6-4-10)13-19-14(23-20-13)15(16,17)18/h3-6,12H,7H2,1-2H3 |
| InChIKey | NFYVFDLYTHEIRX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|