C14H14F3N3O — CID 159614709
N-methyl-4-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]butan-2-imine (PubChem CID 159614709) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is N-methyl-4-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]butan-2-imine.
| Compound Name | N-methyl-4-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]butan-2-imine |
|---|---|
| PubChem CID | 159614709 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-methyl-4-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]butan-2-imine |
| SMILES | C/N=C(\C)CCc1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H14F3N3O/c1-9(18-2)3-4-10-5-7-11(8-6-10)12-19-13(21-20-12)14(15,16)17/h5-8H,3-4H2,1-2H3/b18-9+ |
| InChIKey | MNDHUIYAVJWWED-GIJQJNRQSA-N |
| XLogP | 3.78 |
| TPSA | 51.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|