C11H8F3N3O2 — CID 137313932
N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethylidene]hydroxylamine (PubChem CID 137313932) has the molecular formula C11H8F3N3O2 and a molecular weight of 271.20 g/mol. Its IUPAC name is N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 137313932 |
| Molecular Formula | C11H8F3N3O2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C11H8F3N3O2/c1-6(16-18)7-2-4-8(5-3-7)9-15-10(19-17-9)11(12,13)14/h2-5,18H,1H3 |
| InChIKey | XXLKDNGEJVQIAL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|