C12H9F3N4O3 — CID 159324725
N-[(Z)-methoxyiminomethyl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 159324725) has the molecular formula C12H9F3N4O3 and a molecular weight of 314.22 g/mol. Its IUPAC name is N-[(Z)-methoxyiminomethyl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-[(Z)-methoxyiminomethyl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 159324725 |
| Molecular Formula | C12H9F3N4O3 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-[(Z)-methoxyiminomethyl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | CO/N=C\NC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C12H9F3N4O3/c1-21-17-6-16-10(20)8-4-2-7(3-5-8)9-18-11(22-19-9)12(13,14)15/h2-6H,1H3,(H,16,17,20) |
| InChIKey | SHULZDWNYHRQNK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|