C15H14F4N4O3 — CID 138629849
N-[(1E)-1-(2-fluoroethoxyimino)propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 138629849) has the molecular formula C15H14F4N4O3 and a molecular weight of 374.29 g/mol. Its IUPAC name is N-[(1E)-1-(2-fluoroethoxyimino)propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-[(1E)-1-(2-fluoroethoxyimino)propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 138629849 |
| Molecular Formula | C15H14F4N4O3 |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-[(1E)-1-(2-fluoroethoxyimino)propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | CC(/C=N/OCCF)NC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H14F4N4O3/c1-9(8-20-25-7-6-16)21-13(24)11-4-2-10(3-5-11)12-22-14(26-23-12)15(17,18)19/h2-5,8-9H,6-7H2,1H3,(H,21,24)/b20-8+ |
| InChIKey | HXWNCACOWUGITP-DNTJNYDQSA-N |
| XLogP | 2.85 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|