C20H16F4N4O3 — CID 138629944
N-[1-[(4-fluorophenyl)methoxyimino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 138629944) has the molecular formula C20H16F4N4O3 and a molecular weight of 436.37 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methoxyimino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-[1-[(4-fluorophenyl)methoxyimino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 138629944 |
| Molecular Formula | C20H16F4N4O3 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methoxyimino]propan-2-yl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | CC(C=NOCc1ccc(F)cc1)NC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C20H16F4N4O3/c1-12(10-25-30-11-13-2-8-16(21)9-3-13)26-18(29)15-6-4-14(5-7-15)17-27-19(31-28-17)20(22,23)24/h2-10,12H,11H2,1H3,(H,26,29) |
| InChIKey | SNQGBTOJTSSLLD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|