C20H15ClF4N4O3 — CID 138629904
N-[(1Z)-1-[(2-chloro-4-fluorophenyl)methoxyimino]propan-2-yl]-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 138629904) has the molecular formula C20H15ClF4N4O3 and a molecular weight of 470.81 g/mol. Its IUPAC name is N-[(1Z)-1-[(2-chloro-4-fluorophenyl)methoxyimino]propan-2-yl]-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-[(1Z)-1-[(2-chloro-4-fluorophenyl)methoxyimino]propan-2-yl]-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 138629904 |
| Molecular Formula | C20H15ClF4N4O3 |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[(1Z)-1-[(2-chloro-4-fluorophenyl)methoxyimino]propan-2-yl]-3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | CC(/C=N\OCc1ccc(F)cc1Cl)NC(=O)c1cccc(-c2noc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C20H15ClF4N4O3/c1-11(9-26-31-10-14-5-6-15(22)8-16(14)21)27-18(30)13-4-2-3-12(7-13)17-28-19(32-29-17)20(23,24)25/h2-9,11H,10H2,1H3,(H,27,30)/b26-9- |
| InChIKey | RUBKARQSWKMYEY-WMDMUMDLSA-N |
| XLogP | 4.87 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|