C22H18F6N4O3 — CID 138667968
4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-N-[(4E)-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-yl]benzamide (PubChem CID 138667968) has the molecular formula C22H18F6N4O3 and a molecular weight of 500.40 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-N-[(4E)-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-yl]benzamide.
| Compound Name | 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-N-[(4E)-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 138667968 |
| Molecular Formula | C22H18F6N4O3 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-N-[(4E)-4-[[3-(trifluoromethyl)phenyl]methoxyimino]butan-2-yl]benzamide |
| SMILES | CC(C/C=N/OCc1cccc(C(F)(F)F)c1)NC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C22H18F6N4O3/c1-13(9-10-29-34-12-14-3-2-4-17(11-14)21(23,24)25)30-19(33)16-7-5-15(6-8-16)18-31-20(35-32-18)22(26,27)28/h2-8,10-11,13H,9,12H2,1H3,(H,30,33)/b29-10+ |
| InChIKey | DAPKAJLPEFTSOI-VYVUJPJFSA-N |
| XLogP | 5.49 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|