C13H12F3N3O3 — CID 71230893
N-(3-hydroxypropyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 71230893) has the molecular formula C13H12F3N3O3 and a molecular weight of 315.25 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-(3-hydroxypropyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 71230893 |
| Molecular Formula | C13H12F3N3O3 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-(3-hydroxypropyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | O=C(NCCCO)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C13H12F3N3O3/c14-13(15,16)12-18-10(19-22-12)8-2-4-9(5-3-8)11(21)17-6-1-7-20/h2-5,20H,1,6-7H2,(H,17,21) |
| InChIKey | SMEQBYBFXSFEFT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|