C13H13ClF3N3O2 — CID 142514896
[1-ethoxy-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethylidene]azanium chloride (PubChem CID 142514896) has the molecular formula C13H13ClF3N3O2 and a molecular weight of 335.71 g/mol. Its IUPAC name is [1-ethoxy-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethylidene]azanium chloride.
| Compound Name | [1-ethoxy-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethylidene]azanium chloride |
|---|---|
| PubChem CID | 142514896 |
| Molecular Formula | C13H13ClF3N3O2 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | [1-ethoxy-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethylidene]azanium chloride |
| SMILES | CCOC(=[NH2+])Cc1ccc(-c2noc(C(F)(F)F)n2)cc1.[Cl-] |
| InChI | InChI=1S/C13H12F3N3O2.ClH/c1-2-20-10(17)7-8-3-5-9(6-4-8)11-18-12(21-19-11)13(14,15)16;/h3-6,17H,2,7H2,1H3;1H |
| InChIKey | CFNMOBUXIUXYAK-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|