C12H11F3N4O3 — CID 135326270
1-methoxy-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea (PubChem CID 135326270) has the molecular formula C12H11F3N4O3 and a molecular weight of 316.24 g/mol. Its IUPAC name is 1-methoxy-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea.
| Compound Name | 1-methoxy-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 135326270 |
| Molecular Formula | C12H11F3N4O3 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1-methoxy-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
| SMILES | CONC(=O)NCc1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C12H11F3N4O3/c1-21-19-11(20)16-6-7-2-4-8(5-3-7)9-17-10(22-18-9)12(13,14)15/h2-5H,6H2,1H3,(H2,16,19,20) |
| InChIKey | PCJICLORHNIURM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|