C14H13F3N4O2 — CID 135326353
1-prop-2-enyl-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea (PubChem CID 135326353) has the molecular formula C14H13F3N4O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea.
| Compound Name | 1-prop-2-enyl-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 135326353 |
| Molecular Formula | C14H13F3N4O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-prop-2-enyl-3-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]urea |
| SMILES | C=CCNC(=O)NCc1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H13F3N4O2/c1-2-7-18-13(22)19-8-9-3-5-10(6-4-9)11-20-12(23-21-11)14(15,16)17/h2-6H,1,7-8H2,(H2,18,19,22) |
| InChIKey | NCCVZWWQQDHFBW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|