C13H9F4N3O2 — CID 138489832
2-fluoro-N-prop-2-enyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 138489832) has the molecular formula C13H9F4N3O2 and a molecular weight of 315.23 g/mol. Its IUPAC name is 2-fluoro-N-prop-2-enyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | 2-fluoro-N-prop-2-enyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 138489832 |
| Molecular Formula | C13H9F4N3O2 |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-fluoro-N-prop-2-enyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | C=CCNC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C13H9F4N3O2/c1-2-5-18-11(21)8-4-3-7(6-9(8)14)10-19-12(22-20-10)13(15,16)17/h2-4,6H,1,5H2,(H,18,21) |
| InChIKey | IYBSUDWEZACWSP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|