C15H16F4N4O3 — CID 138668507
N-[1-(ethoxyamino)propan-2-yl]-2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 138668507) has the molecular formula C15H16F4N4O3 and a molecular weight of 376.31 g/mol. Its IUPAC name is N-[1-(ethoxyamino)propan-2-yl]-2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | N-[1-(ethoxyamino)propan-2-yl]-2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 138668507 |
| Molecular Formula | C15H16F4N4O3 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[1-(ethoxyamino)propan-2-yl]-2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | CCONCC(C)NC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C15H16F4N4O3/c1-3-25-20-7-8(2)21-13(24)10-5-4-9(6-11(10)16)12-22-14(26-23-12)15(17,18)19/h4-6,8,20H,3,7H2,1-2H3,(H,21,24) |
| InChIKey | HTNVVXICLVKVQV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|